K7D

?

Summary

Name:4-oxo-8-phenyl-1,4-dihydroquinoline-3-carboxylic acid
Formula:C16 H11 N O3
Formal charge:0
Molecular weight:265.263 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.014-oxo-8-phenyl-1,4-dihydroquinoline-3-carboxylic acid
OpenEye OEToolkits2.0.64-oxidanylidene-8-phenyl-1~{H}-quinoline-3-carboxylic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01c3c(c1cccc2c1NC=C(C(=O)O)C2=O)cccc3
InChIInChI1.03InChI=1S/C16H11NO3/c18-15-12-8-4-7-11(10-5-2-1-3-6-10)14(12)17-9-13(15)16(19)20/h1-9H,(H,17,18)(H,19,20)
InChIKeyInChI1.03IYZQCKZKSCOMCY-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385OC(=O)C1=CNc2c(cccc2c3ccccc3)C1=O
SMILESCACTVS3.385OC(=O)C1=CNc2c(cccc2c3ccccc3)C1=O
SMILES_CANONICALOpenEye OEToolkits2.0.6c1ccc(cc1)c2cccc3c2NC=C(C3=O)C(=O)O
SMILESOpenEye OEToolkits2.0.6c1ccc(cc1)c2cccc3c2NC=C(C3=O)C(=O)O